C10H9ClO3 — CID 96778514
(3S)-5-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 96778514) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is (3S)-5-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | (3S)-5-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 96778514 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | (3S)-5-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1COc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C10H9ClO3/c11-8-2-1-3-9-7(8)4-6(5-14-9)10(12)13/h1-3,6H,4-5H2,(H,12,13)/t6-/m0/s1 |
| InChIKey | LJVZJTXYAQJLQD-LURJTMIESA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |