C11H11ClO2 — CID 165460900
1-(5-chloro-3,4-dihydro-2H-chromen-3-yl)ethanone (PubChem CID 165460900) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 1-(5-chloro-3,4-dihydro-2H-chromen-3-yl)ethanone.
| Compound Name | 1-(5-chloro-3,4-dihydro-2H-chromen-3-yl)ethanone |
|---|---|
| PubChem CID | 165460900 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 1-(5-chloro-3,4-dihydro-2H-chromen-3-yl)ethanone |
| SMILES | CC(=O)C1COc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C11H11ClO2/c1-7(13)8-5-9-10(12)3-2-4-11(9)14-6-8/h2-4,8H,5-6H2,1H3 |
| InChIKey | NTLYGISWPUXWIL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |