About (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid
(3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 130729134) has the molecular formula C10H9IO3
and a molecular weight of 304.08 g/mol. Its IUPAC name is (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid |
| PubChem CID | 130729134 |
| Molecular Formula | C10H9IO3 |
| Molecular Weight | 304.08 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1COc2c(I)cccc2C1 |
| InChI | InChI=1S/C10H9IO3/c11-8-3-1-2-6-4-7(10(12)13)5-14-9(6)8/h1-3,7H,4-5H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | UMQSBFUMDYICGZ-ZETCQYMHSA-N |
| XLogP | 1.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.08 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid?
The IUPAC name of (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid (CID 130729134) is (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid.
What is the SMILES notation for (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid?
The canonical SMILES for (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid is O=C(O)[C@@H]1COc2c(I)cccc2C1.
What is the InChIKey of (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid?
The InChIKey is UMQSBFUMDYICGZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H9IO3/c11-8-3-1-2-6-4-7(10(12)13)5-14-9(6)8/h1-3,7H,4-5H2,(H,12,13)/t7-/m0/s1.
What are the key properties of (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid?
(3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid has a molecular weight of 304.08 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-8-iodo-3,4-dihydro-2H-chromene-3-carboxylic acid is sourced from PubChem (CID 130729134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).