C9H9BrN2 — CID 84725646
3-bromo-2,6-dimethylindazole (PubChem CID 84725646) has the molecular formula C9H9BrN2 and a molecular weight of 225.09 g/mol. Its IUPAC name is 3-bromo-2,6-dimethylindazole.
| Compound Name | 3-bromo-2,6-dimethylindazole |
|---|---|
| PubChem CID | 84725646 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 3-bromo-2,6-dimethylindazole |
| SMILES | Cc1ccc2c(Br)n(C)nc2c1 |
| InChI | InChI=1S/C9H9BrN2/c1-6-3-4-7-8(5-6)11-12(2)9(7)10/h3-5H,1-2H3 |
| InChIKey | LAQBZZZZSBPINK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |