C15H22N2 — CID 176566562
2-(cyclopropylmethyl)-3,6-dimethylindazole;ethane (PubChem CID 176566562) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-3,6-dimethylindazole;ethane.
| Compound Name | 2-(cyclopropylmethyl)-3,6-dimethylindazole;ethane |
|---|---|
| PubChem CID | 176566562 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-(cyclopropylmethyl)-3,6-dimethylindazole;ethane |
| SMILES | CC.Cc1ccc2c(C)n(CC3CC3)nc2c1 |
| InChI | InChI=1S/C13H16N2.C2H6/c1-9-3-6-12-10(2)15(8-11-4-5-11)14-13(12)7-9;1-2/h3,6-7,11H,4-5,8H2,1-2H3;1-2H3 |
| InChIKey | BAVKLKSQRQKEAI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |