C9H9Cl2N3 — CID 84726220
2-(3,4-dichloroindazol-2-yl)ethanamine (PubChem CID 84726220) has the molecular formula C9H9Cl2N3 and a molecular weight of 230.10 g/mol. Its IUPAC name is 2-(3,4-dichloroindazol-2-yl)ethanamine.
| Compound Name | 2-(3,4-dichloroindazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 84726220 |
| Molecular Formula | C9H9Cl2N3 |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-(3,4-dichloroindazol-2-yl)ethanamine |
| SMILES | NCCn1nc2cccc(Cl)c2c1Cl |
| InChI | InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7-8(6)9(11)14(13-7)5-4-12/h1-3H,4-5,12H2 |
| InChIKey | XSGZHHVFCKIHND-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |