C10H9Cl2N3O — CID 117263724
3-(2-aminoethyl)-2,5-dichloroquinazolin-4-one (PubChem CID 117263724) has the molecular formula C10H9Cl2N3O and a molecular weight of 258.11 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2,5-dichloroquinazolin-4-one.
| Compound Name | 3-(2-aminoethyl)-2,5-dichloroquinazolin-4-one |
|---|---|
| PubChem CID | 117263724 |
| Molecular Formula | C10H9Cl2N3O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-(2-aminoethyl)-2,5-dichloroquinazolin-4-one |
| SMILES | NCCn1c(Cl)nc2cccc(Cl)c2c1=O |
| InChI | InChI=1S/C10H9Cl2N3O/c11-6-2-1-3-7-8(6)9(16)15(5-4-13)10(12)14-7/h1-3H,4-5,13H2 |
| InChIKey | BEFKCFUJNRPBMJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |