C10H12F2N2O2 — CID 84726244
2,2-difluoro-2-[5-(2-methylpropyl)pyrimidin-2-yl]acetic acid (PubChem CID 84726244) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2,2-difluoro-2-[5-(2-methylpropyl)pyrimidin-2-yl]acetic acid.
| Compound Name | 2,2-difluoro-2-[5-(2-methylpropyl)pyrimidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 84726244 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2,2-difluoro-2-[5-(2-methylpropyl)pyrimidin-2-yl]acetic acid |
| SMILES | CC(C)Cc1cnc(C(F)(F)C(=O)O)nc1 |
| InChI | InChI=1S/C10H12F2N2O2/c1-6(2)3-7-4-13-8(14-5-7)10(11,12)9(15)16/h4-6H,3H2,1-2H3,(H,15,16) |
| InChIKey | UFSMGYZMXPLVRT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |