C10H15F2N3 — CID 84734901
4-(1,1-difluoroethyl)-1-(pyrrolidin-3-ylmethyl)pyrazole (PubChem CID 84734901) has the molecular formula C10H15F2N3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-(1,1-difluoroethyl)-1-(pyrrolidin-3-ylmethyl)pyrazole.
| Compound Name | 4-(1,1-difluoroethyl)-1-(pyrrolidin-3-ylmethyl)pyrazole |
|---|---|
| PubChem CID | 84734901 |
| Molecular Formula | C10H15F2N3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 4-(1,1-difluoroethyl)-1-(pyrrolidin-3-ylmethyl)pyrazole |
| SMILES | CC(F)(F)c1cnn(CC2CCNC2)c1 |
| InChI | InChI=1S/C10H15F2N3/c1-10(11,12)9-5-14-15(7-9)6-8-2-3-13-4-8/h5,7-8,13H,2-4,6H2,1H3 |
| InChIKey | MLFNLWQFWOZDMV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |