C12H20FN3 — CID 84735734
3-[[4-(2-fluoropropan-2-yl)pyrazol-1-yl]methyl]piperidine (PubChem CID 84735734) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-[[4-(2-fluoropropan-2-yl)pyrazol-1-yl]methyl]piperidine.
| Compound Name | 3-[[4-(2-fluoropropan-2-yl)pyrazol-1-yl]methyl]piperidine |
|---|---|
| PubChem CID | 84735734 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 3-[[4-(2-fluoropropan-2-yl)pyrazol-1-yl]methyl]piperidine |
| SMILES | CC(C)(F)c1cnn(CC2CCCNC2)c1 |
| InChI | InChI=1S/C12H20FN3/c1-12(2,13)11-7-15-16(9-11)8-10-4-3-5-14-6-10/h7,9-10,14H,3-6,8H2,1-2H3 |
| InChIKey | UCESEYNZOMPBET-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |