C12H19N3O2 — CID 84736666
2-[2-[2-(aminomethyl)cyclohexyl]pyrazol-3-yl]acetic acid (PubChem CID 84736666) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[2-[2-(aminomethyl)cyclohexyl]pyrazol-3-yl]acetic acid.
| Compound Name | 2-[2-[2-(aminomethyl)cyclohexyl]pyrazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 84736666 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[2-[2-(aminomethyl)cyclohexyl]pyrazol-3-yl]acetic acid |
| SMILES | NCC1CCCCC1n1nccc1CC(=O)O |
| InChI | InChI=1S/C12H19N3O2/c13-8-9-3-1-2-4-11(9)15-10(5-6-14-15)7-12(16)17/h5-6,9,11H,1-4,7-8,13H2,(H,16,17) |
| InChIKey | DLHBFBLXEWKPEK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |