C14H12ClNO — CID 84737389
2-(7-chloro-2,3-dihydro-1H-isoindol-1-yl)phenol (PubChem CID 84737389) has the molecular formula C14H12ClNO and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-(7-chloro-2,3-dihydro-1H-isoindol-1-yl)phenol.
| Compound Name | 2-(7-chloro-2,3-dihydro-1H-isoindol-1-yl)phenol |
|---|---|
| PubChem CID | 84737389 |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-(7-chloro-2,3-dihydro-1H-isoindol-1-yl)phenol |
| SMILES | Oc1ccccc1C1NCc2cccc(Cl)c21 |
| InChI | InChI=1S/C14H12ClNO/c15-11-6-3-4-9-8-16-14(13(9)11)10-5-1-2-7-12(10)17/h1-7,14,16-17H,8H2 |
| InChIKey | YPHYVDJCWIGDNM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|