C11H13N3O — CID 84739779
7-methyl-3-(methylaminomethyl)imidazo[1,5-a]pyridine-1-carbaldehyde (PubChem CID 84739779) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 7-methyl-3-(methylaminomethyl)imidazo[1,5-a]pyridine-1-carbaldehyde.
| Compound Name | 7-methyl-3-(methylaminomethyl)imidazo[1,5-a]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 84739779 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 7-methyl-3-(methylaminomethyl)imidazo[1,5-a]pyridine-1-carbaldehyde |
| SMILES | CNCc1nc(C=O)c2cc(C)ccn12 |
| InChI | InChI=1S/C11H13N3O/c1-8-3-4-14-10(5-8)9(7-15)13-11(14)6-12-2/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | XWIKPZYUEAPENQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|