About N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine
N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine (PubChem CID 84742521) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine |
| PubChem CID | 84742521 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine |
| SMILES | CN(C)c1ccn2c(CC3CCNCC3)ncc2c1 |
| InChI | InChI=1S/C15H22N4/c1-18(2)13-5-8-19-14(10-13)11-17-15(19)9-12-3-6-16-7-4-12/h5,8,10-12,16H,3-4,6-7,9H2,1-2H3 |
| InChIKey | KMWBZDHKIZHXDX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine?
The IUPAC name of N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine (CID 84742521) is N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine.
What is the SMILES notation for N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine?
The canonical SMILES for N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine is CN(C)c1ccn2c(CC3CCNCC3)ncc2c1.
What is the InChIKey of N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine?
The InChIKey is KMWBZDHKIZHXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-18(2)13-5-8-19-14(10-13)11-17-15(19)9-12-3-6-16-7-4-12/h5,8,10-12,16H,3-4,6-7,9H2,1-2H3.
What are the key properties of N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine?
N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine has a molecular weight of 258.37 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-(piperidin-4-ylmethyl)imidazo[1,5-a]pyridin-7-amine is sourced from PubChem (CID 84742521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).