C14H17ClN2O — CID 84742810
5-chloro-8-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-amine (PubChem CID 84742810) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 5-chloro-8-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-amine.
| Compound Name | 5-chloro-8-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-amine |
|---|---|
| PubChem CID | 84742810 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-chloro-8-methoxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-amine |
| SMILES | COc1ccc(Cl)c2c3c(n(C)c12)CCCC3N |
| InChI | InChI=1S/C14H17ClN2O/c1-17-10-5-3-4-9(16)13(10)12-8(15)6-7-11(18-2)14(12)17/h6-7,9H,3-5,16H2,1-2H3 |
| InChIKey | DSLOTZQIQNXDGI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |