C16H23N3O — CID 84743241
2-(6-methoxy-2,8-dimethyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethanamine (PubChem CID 84743241) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-(6-methoxy-2,8-dimethyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethanamine.
| Compound Name | 2-(6-methoxy-2,8-dimethyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethanamine |
|---|---|
| PubChem CID | 84743241 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2-(6-methoxy-2,8-dimethyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethanamine |
| SMILES | COc1cc(C)cc2c(CCN)c3n(c12)CCN(C)C3 |
| InChI | InChI=1S/C16H23N3O/c1-11-8-13-12(4-5-17)14-10-18(2)6-7-19(14)16(13)15(9-11)20-3/h8-9H,4-7,10,17H2,1-3H3 |
| InChIKey | LPWPWYZXKWDEBI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|