C12H22BrN5 — CID 84744537
2-(4-bromo-2-methyl-1H-imidazol-5-yl)-N-methyl-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 84744537) has the molecular formula C12H22BrN5 and a molecular weight of 316.25 g/mol. Its IUPAC name is 2-(4-bromo-2-methyl-1H-imidazol-5-yl)-N-methyl-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-methyl-1H-imidazol-5-yl)-N-methyl-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 84744537 |
| Molecular Formula | C12H22BrN5 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(4-bromo-2-methyl-1H-imidazol-5-yl)-N-methyl-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | CNCC(c1[nH]c(C)nc1Br)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H22BrN5/c1-9-15-11(12(13)16-9)10(8-14-2)18-6-4-17(3)5-7-18/h10,14H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | OBWSFQKVRSIWGA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |