C11H20BrN5 — CID 84744145
2-(4-bromo-2-methyl-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 84744145) has the molecular formula C11H20BrN5 and a molecular weight of 302.22 g/mol. Its IUPAC name is 2-(4-bromo-2-methyl-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-methyl-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 84744145 |
| Molecular Formula | C11H20BrN5 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(4-bromo-2-methyl-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | Cc1nc(Br)c(C(CN)N2CCN(C)CC2)[nH]1 |
| InChI | InChI=1S/C11H20BrN5/c1-8-14-10(11(12)15-8)9(7-13)17-5-3-16(2)4-6-17/h9H,3-7,13H2,1-2H3,(H,14,15) |
| InChIKey | VGPADRTYTSXEMP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |