C10H18ClN5 — CID 84741551
2-(4-chloro-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 84741551) has the molecular formula C10H18ClN5 and a molecular weight of 243.74 g/mol. Its IUPAC name is 2-(4-chloro-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(4-chloro-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 84741551 |
| Molecular Formula | C10H18ClN5 |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-(4-chloro-1H-imidazol-5-yl)-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | CN1CCN(C(CN)c2[nH]cnc2Cl)CC1 |
| InChI | InChI=1S/C10H18ClN5/c1-15-2-4-16(5-3-15)8(6-12)9-10(11)14-7-13-9/h7-8H,2-6,12H2,1H3,(H,13,14) |
| InChIKey | QXDJCGLNBDDHLR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |