C22H22ClN5 — CID 84745710
2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)acetonitrile (PubChem CID 84745710) has the molecular formula C22H22ClN5 and a molecular weight of 391.91 g/mol. Its IUPAC name is 2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)acetonitrile.
| Compound Name | 2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 84745710 |
| Molecular Formula | C22H22ClN5 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)acetonitrile |
| SMILES | Cn1c(-c2ccccc2)nc(C(C#N)N2CCN(c3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C22H22ClN5/c1-26-21(23)20(25-22(26)17-8-4-2-5-9-17)19(16-24)28-14-12-27(13-15-28)18-10-6-3-7-11-18/h2-11,19H,12-15H2,1H3 |
| InChIKey | POLSSXOPOKPTBT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |