C22H26ClN5 — CID 84745726
2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)ethanamine (PubChem CID 84745726) has the molecular formula C22H26ClN5 and a molecular weight of 395.94 g/mol. Its IUPAC name is 2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 84745726 |
| Molecular Formula | C22H26ClN5 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-(5-chloro-1-methyl-2-phenylimidazol-4-yl)-2-(4-phenylpiperazin-1-yl)ethanamine |
| SMILES | Cn1c(-c2ccccc2)nc(C(CN)N2CCN(c3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C22H26ClN5/c1-26-21(23)20(25-22(26)17-8-4-2-5-9-17)19(16-24)28-14-12-27(13-15-28)18-10-6-3-7-11-18/h2-11,19H,12-16,24H2,1H3 |
| InChIKey | BLKLQAQYGIPRLY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |