C18H26ClN5 — CID 84745436
2-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-2-(4-ethylpiperazin-1-yl)ethanamine (PubChem CID 84745436) has the molecular formula C18H26ClN5 and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-2-(4-ethylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-2-(4-ethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 84745436 |
| Molecular Formula | C18H26ClN5 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-(5-chloro-3-methyl-2-phenylimidazol-4-yl)-2-(4-ethylpiperazin-1-yl)ethanamine |
| SMILES | CCN1CCN(C(CN)c2c(Cl)nc(-c3ccccc3)n2C)CC1 |
| InChI | InChI=1S/C18H26ClN5/c1-3-23-9-11-24(12-10-23)15(13-20)16-17(19)21-18(22(16)2)14-7-5-4-6-8-14/h4-8,15H,3,9-13,20H2,1-2H3 |
| InChIKey | VBQSTYMFDKODIJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |