3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid

C11H11Cl2NO4 — CID 84746998

IUPAC3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid
SMILESO=C(O)CCNC(C(=O)O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NO4/c12-7-2-1-6(5-8(7)13)10(11(17)18)14-4-3-9(15)16/h1-2,5,10,14H,3-4H2,(H,15,16)(H,17,18)
InChIKeyDNTMXVMCXBKFAJ-UHFFFAOYSA-N
MW292.12 g/mol
LogP2.18
Rot. Bonds6

About 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid

3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid (PubChem CID 84746998) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid.

Molecular Properties

Compound Name3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid
PubChem CID84746998
Molecular FormulaC11H11Cl2NO4
Molecular Weight292.12 g/mol
Exact Mass291.01
IUPAC Name3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid
SMILESO=C(O)CCNC(C(=O)O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NO4/c12-7-2-1-6(5-8(7)13)10(11(17)18)14-4-3-9(15)16/h1-2,5,10,14H,3-4H2,(H,15,16)(H,17,18)
InChIKeyDNTMXVMCXBKFAJ-UHFFFAOYSA-N
XLogP2.18
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.12
LogP ≤ 52.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid?
The IUPAC name of 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid (CID 84746998) is 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid.
What is the SMILES notation for 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid?
The canonical SMILES for 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid is O=C(O)CCNC(C(=O)O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid?
The InChIKey is DNTMXVMCXBKFAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NO4/c12-7-2-1-6(5-8(7)13)10(11(17)18)14-4-3-9(15)16/h1-2,5,10,14H,3-4H2,(H,15,16)(H,17,18).
What are the key properties of 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid?
3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid has a molecular weight of 292.12 g/mol, XLogP of 2.18, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[carboxy-(3,4-dichlorophenyl)methyl]amino]propanoic acid is sourced from PubChem (CID 84746998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).