C16H26N2 — CID 84747850
1-(4-propan-2-ylphenyl)-2-pyrrolidin-1-ylpropan-2-amine (PubChem CID 84747850) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-2-pyrrolidin-1-ylpropan-2-amine.
| Compound Name | 1-(4-propan-2-ylphenyl)-2-pyrrolidin-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 84747850 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-2-pyrrolidin-1-ylpropan-2-amine |
| SMILES | CC(C)c1ccc(CC(C)(N)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H26N2/c1-13(2)15-8-6-14(7-9-15)12-16(3,17)18-10-4-5-11-18/h6-9,13H,4-5,10-12,17H2,1-3H3 |
| InChIKey | HNRQIWRYQCIREU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |