C19H28N2 — CID 84751695
2-methyl-2-(3-methylpiperidin-1-yl)-3-(4-propan-2-ylphenyl)propanenitrile (PubChem CID 84751695) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-methyl-2-(3-methylpiperidin-1-yl)-3-(4-propan-2-ylphenyl)propanenitrile.
| Compound Name | 2-methyl-2-(3-methylpiperidin-1-yl)-3-(4-propan-2-ylphenyl)propanenitrile |
|---|---|
| PubChem CID | 84751695 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-methyl-2-(3-methylpiperidin-1-yl)-3-(4-propan-2-ylphenyl)propanenitrile |
| SMILES | CC1CCCN(C(C)(C#N)Cc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C19H28N2/c1-15(2)18-9-7-17(8-10-18)12-19(4,14-20)21-11-5-6-16(3)13-21/h7-10,15-16H,5-6,11-13H2,1-4H3 |
| InChIKey | XWRYOUHEWOYRSV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |