C14H21FN2S — CID 84749057
2-[butyl(ethyl)amino]-2-(4-fluorophenyl)ethanethioamide (PubChem CID 84749057) has the molecular formula C14H21FN2S and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-2-(4-fluorophenyl)ethanethioamide.
| Compound Name | 2-[butyl(ethyl)amino]-2-(4-fluorophenyl)ethanethioamide |
|---|---|
| PubChem CID | 84749057 |
| Molecular Formula | C14H21FN2S |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[butyl(ethyl)amino]-2-(4-fluorophenyl)ethanethioamide |
| SMILES | CCCCN(CC)C(C(N)=S)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2S/c1-3-5-10-17(4-2)13(14(16)18)11-6-8-12(15)9-7-11/h6-9,13H,3-5,10H2,1-2H3,(H2,16,18) |
| InChIKey | GTOMPZYGAKUMPD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|