C9H14N2OS2 — CID 84749719
2-[2-hydroxyethyl(methyl)amino]-2-thiophen-3-ylethanethioamide (PubChem CID 84749719) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(methyl)amino]-2-thiophen-3-ylethanethioamide.
| Compound Name | 2-[2-hydroxyethyl(methyl)amino]-2-thiophen-3-ylethanethioamide |
|---|---|
| PubChem CID | 84749719 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-[2-hydroxyethyl(methyl)amino]-2-thiophen-3-ylethanethioamide |
| SMILES | CN(CCO)C(C(N)=S)c1ccsc1 |
| InChI | InChI=1S/C9H14N2OS2/c1-11(3-4-12)8(9(10)13)7-2-5-14-6-7/h2,5-6,8,12H,3-4H2,1H3,(H2,10,13) |
| InChIKey | IWMLYQGFQWBDGP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|