C17H28N2O2 — CID 84750567
N,N-dimethyl-4-[(oxolan-2-ylmethylamino)methyl]-2-propan-2-yloxyaniline (PubChem CID 84750567) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[(oxolan-2-ylmethylamino)methyl]-2-propan-2-yloxyaniline.
| Compound Name | N,N-dimethyl-4-[(oxolan-2-ylmethylamino)methyl]-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 84750567 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N,N-dimethyl-4-[(oxolan-2-ylmethylamino)methyl]-2-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(CNCC2CCCO2)ccc1N(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-13(2)21-17-10-14(7-8-16(17)19(3)4)11-18-12-15-6-5-9-20-15/h7-8,10,13,15,18H,5-6,9,11-12H2,1-4H3 |
| InChIKey | UTNUJJUUYJVRBK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|