C19H32N2O — CID 84750578
N,N-dimethyl-4-[[(2-methylcyclohexyl)amino]methyl]-2-propan-2-yloxyaniline (PubChem CID 84750578) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[[(2-methylcyclohexyl)amino]methyl]-2-propan-2-yloxyaniline.
| Compound Name | N,N-dimethyl-4-[[(2-methylcyclohexyl)amino]methyl]-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 84750578 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N,N-dimethyl-4-[[(2-methylcyclohexyl)amino]methyl]-2-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(CNC2CCCCC2C)ccc1N(C)C |
| InChI | InChI=1S/C19H32N2O/c1-14(2)22-19-12-16(10-11-18(19)21(4)5)13-20-17-9-7-6-8-15(17)3/h10-12,14-15,17,20H,6-9,13H2,1-5H3 |
| InChIKey | RSDYWKNYDFRDRS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|