C19H32N2O — CID 84750601
N-[(4-piperidin-1-yl-3-propan-2-yloxyphenyl)methyl]butan-2-amine (PubChem CID 84750601) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is N-[(4-piperidin-1-yl-3-propan-2-yloxyphenyl)methyl]butan-2-amine.
| Compound Name | N-[(4-piperidin-1-yl-3-propan-2-yloxyphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 84750601 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N-[(4-piperidin-1-yl-3-propan-2-yloxyphenyl)methyl]butan-2-amine |
| SMILES | CCC(C)NCc1ccc(N2CCCCC2)c(OC(C)C)c1 |
| InChI | InChI=1S/C19H32N2O/c1-5-16(4)20-14-17-9-10-18(19(13-17)22-15(2)3)21-11-7-6-8-12-21/h9-10,13,15-16,20H,5-8,11-12,14H2,1-4H3 |
| InChIKey | GHGKMPNDJNGGDA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|