C18H29N3O — CID 84750655
N-[[4-(1,4-diazepan-1-yl)-3-propan-2-yloxyphenyl]methyl]cyclopropanamine (PubChem CID 84750655) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[[4-(1,4-diazepan-1-yl)-3-propan-2-yloxyphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(1,4-diazepan-1-yl)-3-propan-2-yloxyphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 84750655 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-[[4-(1,4-diazepan-1-yl)-3-propan-2-yloxyphenyl]methyl]cyclopropanamine |
| SMILES | CC(C)Oc1cc(CNC2CC2)ccc1N1CCCNCC1 |
| InChI | InChI=1S/C18H29N3O/c1-14(2)22-18-12-15(13-20-16-5-6-16)4-7-17(18)21-10-3-8-19-9-11-21/h4,7,12,14,16,19-20H,3,5-6,8-11,13H2,1-2H3 |
| InChIKey | GLUCSLXUDXXDLI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|