C17H24FNO2 — CID 84751556
1-[1-(3-fluorophenyl)-3-methylbutan-2-yl]piperidine-3-carboxylic acid (PubChem CID 84751556) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)-3-methylbutan-2-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-(3-fluorophenyl)-3-methylbutan-2-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 84751556 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-[1-(3-fluorophenyl)-3-methylbutan-2-yl]piperidine-3-carboxylic acid |
| SMILES | CC(C)C(Cc1cccc(F)c1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C17H24FNO2/c1-12(2)16(10-13-5-3-7-15(18)9-13)19-8-4-6-14(11-19)17(20)21/h3,5,7,9,12,14,16H,4,6,8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | DGWPDPZFYHBBTM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |