C17H27NO2 — CID 84752883
2-[[4-(diethylaminomethyl)phenyl]methyl]pentanoic acid (PubChem CID 84752883) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[[4-(diethylaminomethyl)phenyl]methyl]pentanoic acid.
| Compound Name | 2-[[4-(diethylaminomethyl)phenyl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 84752883 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[[4-(diethylaminomethyl)phenyl]methyl]pentanoic acid |
| SMILES | CCCC(Cc1ccc(CN(CC)CC)cc1)C(=O)O |
| InChI | InChI=1S/C17H27NO2/c1-4-7-16(17(19)20)12-14-8-10-15(11-9-14)13-18(5-2)6-3/h8-11,16H,4-7,12-13H2,1-3H3,(H,19,20) |
| InChIKey | RVMOZYQYFDXJPZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |