C16H24FN3O2 — CID 84753447
3-[[3-(4-ethylpiperazin-1-yl)-4-fluorophenyl]methylamino]propanoic acid (PubChem CID 84753447) has the molecular formula C16H24FN3O2 and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[[3-(4-ethylpiperazin-1-yl)-4-fluorophenyl]methylamino]propanoic acid.
| Compound Name | 3-[[3-(4-ethylpiperazin-1-yl)-4-fluorophenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 84753447 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-[[3-(4-ethylpiperazin-1-yl)-4-fluorophenyl]methylamino]propanoic acid |
| SMILES | CCN1CCN(c2cc(CNCCC(=O)O)ccc2F)CC1 |
| InChI | InChI=1S/C16H24FN3O2/c1-2-19-7-9-20(10-8-19)15-11-13(3-4-14(15)17)12-18-6-5-16(21)22/h3-4,11,18H,2,5-10,12H2,1H3,(H,21,22) |
| InChIKey | SDRTXWXLOOMAQF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|