C20H25FN2 — CID 84753885
N-[(4-fluoro-3-piperidin-1-ylphenyl)methyl]-2-phenylethanamine (PubChem CID 84753885) has the molecular formula C20H25FN2 and a molecular weight of 312.43 g/mol. Its IUPAC name is N-[(4-fluoro-3-piperidin-1-ylphenyl)methyl]-2-phenylethanamine.
| Compound Name | N-[(4-fluoro-3-piperidin-1-ylphenyl)methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 84753885 |
| Molecular Formula | C20H25FN2 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[(4-fluoro-3-piperidin-1-ylphenyl)methyl]-2-phenylethanamine |
| SMILES | Fc1ccc(CNCCc2ccccc2)cc1N1CCCCC1 |
| InChI | InChI=1S/C20H25FN2/c21-19-10-9-18(15-20(19)23-13-5-2-6-14-23)16-22-12-11-17-7-3-1-4-8-17/h1,3-4,7-10,15,22H,2,5-6,11-14,16H2 |
| InChIKey | CUXQSHJLJWULLT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|