C18H23FN2O — CID 84753234
1-[3-(azepan-1-yl)-4-fluorophenyl]-N-(furan-2-ylmethyl)methanamine (PubChem CID 84753234) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)-4-fluorophenyl]-N-(furan-2-ylmethyl)methanamine.
| Compound Name | 1-[3-(azepan-1-yl)-4-fluorophenyl]-N-(furan-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 84753234 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-[3-(azepan-1-yl)-4-fluorophenyl]-N-(furan-2-ylmethyl)methanamine |
| SMILES | Fc1ccc(CNCc2ccco2)cc1N1CCCCCC1 |
| InChI | InChI=1S/C18H23FN2O/c19-17-8-7-15(13-20-14-16-6-5-11-22-16)12-18(17)21-9-3-1-2-4-10-21/h5-8,11-12,20H,1-4,9-10,13-14H2 |
| InChIKey | QSHLCMHRSHQOML-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |