C21H23FN4O — CID 47052543
1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-N-(furan-2-ylmethyl)methanamine (PubChem CID 47052543) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-N-(furan-2-ylmethyl)methanamine.
| Compound Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-N-(furan-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 47052543 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-N-(furan-2-ylmethyl)methanamine |
| SMILES | Fc1ccc(N2CCN(c3cc(CNCc4ccco4)ccn3)CC2)cc1 |
| InChI | InChI=1S/C21H23FN4O/c22-18-3-5-19(6-4-18)25-9-11-26(12-10-25)21-14-17(7-8-24-21)15-23-16-20-2-1-13-27-20/h1-8,13-14,23H,9-12,15-16H2 |
| InChIKey | GXVXKLHIMQMIGG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |