C16H24N2O4 — CID 84754745
3-[[4-(4-hydroxypiperidin-1-yl)-3-methoxyphenyl]methylamino]propanoic acid (PubChem CID 84754745) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-[[4-(4-hydroxypiperidin-1-yl)-3-methoxyphenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-(4-hydroxypiperidin-1-yl)-3-methoxyphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 84754745 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-[[4-(4-hydroxypiperidin-1-yl)-3-methoxyphenyl]methylamino]propanoic acid |
| SMILES | COc1cc(CNCCC(=O)O)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C16H24N2O4/c1-22-15-10-12(11-17-7-4-16(20)21)2-3-14(15)18-8-5-13(19)6-9-18/h2-3,10,13,17,19H,4-9,11H2,1H3,(H,20,21) |
| InChIKey | JLTZTEAXNPLZRC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|