C12H17NO5S — CID 84755122
methyl 5-(piperidin-3-ylsulfonylmethyl)furan-2-carboxylate (PubChem CID 84755122) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 5-(piperidin-3-ylsulfonylmethyl)furan-2-carboxylate.
| Compound Name | methyl 5-(piperidin-3-ylsulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 84755122 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 5-(piperidin-3-ylsulfonylmethyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)C2CCCNC2)o1 |
| InChI | InChI=1S/C12H17NO5S/c1-17-12(14)11-5-4-9(18-11)8-19(15,16)10-3-2-6-13-7-10/h4-5,10,13H,2-3,6-8H2,1H3 |
| InChIKey | DLMPLQOIMQVTAB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |