C11H8ClN3S — CID 84756323
7-chloro-2-thiophen-2-ylimidazo[1,2-a]pyridin-6-amine (PubChem CID 84756323) has the molecular formula C11H8ClN3S and a molecular weight of 249.73 g/mol. Its IUPAC name is 7-chloro-2-thiophen-2-ylimidazo[1,2-a]pyridin-6-amine.
| Compound Name | 7-chloro-2-thiophen-2-ylimidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 84756323 |
| Molecular Formula | C11H8ClN3S |
| Molecular Weight | 249.73 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 7-chloro-2-thiophen-2-ylimidazo[1,2-a]pyridin-6-amine |
| SMILES | Nc1cn2cc(-c3cccs3)nc2cc1Cl |
| InChI | InChI=1S/C11H8ClN3S/c12-7-4-11-14-9(10-2-1-3-16-10)6-15(11)5-8(7)13/h1-6H,13H2 |
| InChIKey | XAORBXAQCIGXHJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |