C19H22N2 — CID 84756695
2-(3,5-dimethylpiperidin-1-yl)-2-naphthalen-1-ylacetonitrile (PubChem CID 84756695) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-2-naphthalen-1-ylacetonitrile.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-2-naphthalen-1-ylacetonitrile |
|---|---|
| PubChem CID | 84756695 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-2-naphthalen-1-ylacetonitrile |
| SMILES | CC1CC(C)CN(C(C#N)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C19H22N2/c1-14-10-15(2)13-21(12-14)19(11-20)18-9-5-7-16-6-3-4-8-17(16)18/h3-9,14-15,19H,10,12-13H2,1-2H3 |
| InChIKey | GKZRZWCDNQGYKC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |