C14H21NO3 — CID 84758482
3-[[bis(2-methoxyethyl)amino]methyl]benzaldehyde (PubChem CID 84758482) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[[bis(2-methoxyethyl)amino]methyl]benzaldehyde.
| Compound Name | 3-[[bis(2-methoxyethyl)amino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 84758482 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-[[bis(2-methoxyethyl)amino]methyl]benzaldehyde |
| SMILES | COCCN(CCOC)Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C14H21NO3/c1-17-8-6-15(7-9-18-2)11-13-4-3-5-14(10-13)12-16/h3-5,10,12H,6-9,11H2,1-2H3 |
| InChIKey | ANINYTAUMKRQOK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|