C13H15N5O3 — CID 84758832
3-[1-[2-(4-methylanilino)-2-oxoethyl]tetrazol-5-yl]propanoic acid (PubChem CID 84758832) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-[1-[2-(4-methylanilino)-2-oxoethyl]tetrazol-5-yl]propanoic acid.
| Compound Name | 3-[1-[2-(4-methylanilino)-2-oxoethyl]tetrazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 84758832 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-[1-[2-(4-methylanilino)-2-oxoethyl]tetrazol-5-yl]propanoic acid |
| SMILES | Cc1ccc(NC(=O)Cn2nnnc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H15N5O3/c1-9-2-4-10(5-3-9)14-12(19)8-18-11(15-16-17-18)6-7-13(20)21/h2-5H,6-8H2,1H3,(H,14,19)(H,20,21) |
| InChIKey | XXHMKHOUNYRXJM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |