C12H11Br2N3O — CID 114692612
2-(3,5-dibromopyrazol-1-yl)-N-(4-methylphenyl)acetamide (PubChem CID 114692612) has the molecular formula C12H11Br2N3O and a molecular weight of 373.05 g/mol. Its IUPAC name is 2-(3,5-dibromopyrazol-1-yl)-N-(4-methylphenyl)acetamide.
| Compound Name | 2-(3,5-dibromopyrazol-1-yl)-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 114692612 |
| Molecular Formula | C12H11Br2N3O |
| Molecular Weight | 373.05 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 2-(3,5-dibromopyrazol-1-yl)-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C12H11Br2N3O/c1-8-2-4-9(5-3-8)15-12(18)7-17-11(14)6-10(13)16-17/h2-6H,7H2,1H3,(H,15,18) |
| InChIKey | UPAQUICLCGVKSI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |