C12H15BrN5O+ — CID 2329814
2-(4-amino-3,5-dimethyl-1,2,4-triazol-4-ium-1-yl)-N-(4-bromophenyl)acetamide (PubChem CID 2329814) has the molecular formula C12H15BrN5O+ and a molecular weight of 325.19 g/mol. Its IUPAC name is 2-(4-amino-3,5-dimethyl-1,2,4-triazol-4-ium-1-yl)-N-(4-bromophenyl)acetamide.
| Compound Name | 2-(4-amino-3,5-dimethyl-1,2,4-triazol-4-ium-1-yl)-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 2329814 |
| Molecular Formula | C12H15BrN5O+ |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(4-amino-3,5-dimethyl-1,2,4-triazol-4-ium-1-yl)-N-(4-bromophenyl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ccc(Br)cc2)c(C)[n+]1N |
| InChI | InChI=1S/C12H14BrN5O/c1-8-16-17(9(2)18(8)14)7-12(19)15-11-5-3-10(13)4-6-11/h3-6H,7,14H2,1-2H3/p+1 |
| InChIKey | IYJLTJVXPPCSKP-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|