C14H18N6O — CID 84759786
2-[5-(3-methylphenyl)tetrazol-1-yl]-1-piperazin-1-ylethanone (PubChem CID 84759786) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-[5-(3-methylphenyl)tetrazol-1-yl]-1-piperazin-1-ylethanone.
| Compound Name | 2-[5-(3-methylphenyl)tetrazol-1-yl]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 84759786 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-[5-(3-methylphenyl)tetrazol-1-yl]-1-piperazin-1-ylethanone |
| SMILES | Cc1cccc(-c2nnnn2CC(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H18N6O/c1-11-3-2-4-12(9-11)14-16-17-18-20(14)10-13(21)19-7-5-15-6-8-19/h2-4,9,15H,5-8,10H2,1H3 |
| InChIKey | XUWBRDHLSWUTHG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |