C8H11ClN4O4S — CID 84761026
N'-[(4-chloro-2-nitrophenyl)sulfamoyl]ethane-1,2-diamine (PubChem CID 84761026) has the molecular formula C8H11ClN4O4S and a molecular weight of 294.72 g/mol. Its IUPAC name is N'-[(4-chloro-2-nitrophenyl)sulfamoyl]ethane-1,2-diamine.
| Compound Name | N'-[(4-chloro-2-nitrophenyl)sulfamoyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 84761026 |
| Molecular Formula | C8H11ClN4O4S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | N'-[(4-chloro-2-nitrophenyl)sulfamoyl]ethane-1,2-diamine |
| SMILES | NCCNS(=O)(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11ClN4O4S/c9-6-1-2-7(8(5-6)13(14)15)12-18(16,17)11-4-3-10/h1-2,5,11-12H,3-4,10H2 |
| InChIKey | UKXQMDVIDHFINY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|