C15H15N3O3 — CID 84761409
3-(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)-1-methylpyrazole-5-carbaldehyde (PubChem CID 84761409) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)-1-methylpyrazole-5-carbaldehyde.
| Compound Name | 3-(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)-1-methylpyrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 84761409 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)-1-methylpyrazole-5-carbaldehyde |
| SMILES | CC1Oc2ccc(-c3cc(C=O)n(C)n3)cc2N(C)C1=O |
| InChI | InChI=1S/C15H15N3O3/c1-9-15(20)17(2)13-6-10(4-5-14(13)21-9)12-7-11(8-19)18(3)16-12/h4-9H,1-3H3 |
| InChIKey | WIEITRGOZUJRTE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|