C6H10FN3 — CID 84762762
1-[2-(fluoromethyl)-1H-imidazol-5-yl]-N-methylmethanamine (PubChem CID 84762762) has the molecular formula C6H10FN3 and a molecular weight of 143.16 g/mol. Its IUPAC name is 1-[2-(fluoromethyl)-1H-imidazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(fluoromethyl)-1H-imidazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 84762762 |
| Molecular Formula | C6H10FN3 |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 1-[2-(fluoromethyl)-1H-imidazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1cnc(CF)[nH]1 |
| InChI | InChI=1S/C6H10FN3/c1-8-3-5-4-9-6(2-7)10-5/h4,8H,2-3H2,1H3,(H,9,10) |
| InChIKey | PGDMITBGBQEPCQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |