C6H5F2NO2 — CID 84764295
1-[4-(difluoromethyl)-1,3-oxazol-2-yl]ethanone (PubChem CID 84764295) has the molecular formula C6H5F2NO2 and a molecular weight of 161.11 g/mol. Its IUPAC name is 1-[4-(difluoromethyl)-1,3-oxazol-2-yl]ethanone.
| Compound Name | 1-[4-(difluoromethyl)-1,3-oxazol-2-yl]ethanone |
|---|---|
| PubChem CID | 84764295 |
| Molecular Formula | C6H5F2NO2 |
| Molecular Weight | 161.11 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 1-[4-(difluoromethyl)-1,3-oxazol-2-yl]ethanone |
| SMILES | CC(=O)c1nc(C(F)F)co1 |
| InChI | InChI=1S/C6H5F2NO2/c1-3(10)6-9-4(2-11-6)5(7)8/h2,5H,1H3 |
| InChIKey | AICOCWGWXUGLFL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.11 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |